![1-[(4-chlorophenyl)methyl]indole-3-carbaldehyde (CAS: 75629-57-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0734916.png "1-[(4-chlorophenyl)methyl]indole-3-carbaldehyde chemical structure")
1-[(4-chlorophenyl)methyl]indole-3-carbaldehyde
Catalog No: FT-0734916
CAS No: 75629-57-1
- Chemical Name: 1-[(4-chlorophenyl)methyl]indole-3-carbaldehyde
- Molecular Formula: C16H12ClNO
- Molecular Weight: 269.72
- InChI Key: ZDRQMXCSSAPUMM-UHFFFAOYSA-N
- InChI: InChI=1S/C16H12ClNO/c17-14-7-5-12(6-8-14)9-18-10-13(11-19)15-3-1-2-4-16(15)18/h1-8,10-11H,9H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 465.5ºC at 760 mmHg |
|---|---|
| CAS: | 75629-57-1 |
| MF: | C16H12ClNO |
| Density: | 1.21g/cm3 |
| Melting_Point: | N/A |
| Product_Name: | Oncrasin-1 |
| Flash_Point: | 235.3ºC |
| FW: | 269.72600 |
| Density: | 1.21g/cm3 |
|---|---|
| MF: | C16H12ClNO |
| LogP: | 4.15550 |
| Exact_Mass: | 269.06100 |
| Bolling_Point: | 465.5ºC at 760 mmHg |
| Flash_Point: | 235.3ºC |
| FW: | 269.72600 |
| Refractive_Index: | 1.62 |
| PSA: | 22.00000 |
| Hazard_Codes: | Xi |
|---|---|
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
