3-methoxycyclohexane-1-carboxylic acid
Catalog No: FT-0733434
CAS No: 99799-10-7
- Chemical Name: 3-methoxycyclohexane-1-carboxylic acid
- Molecular Formula: C8H14O3
- Molecular Weight: 158.19
- InChI Key: KAWNRNMMEKTYGM-UHFFFAOYSA-N
- InChI: InChI=1S/C8H14O3/c1-11-7-4-2-3-6(5-7)8(9)10/h6-7H,2-5H2,1H3,(H,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 99799-10-7 |
|---|---|
| MF: | C8H14O3 |
| Density: | 1.087 g/mL at 25ºC(lit.) |
| Flash_Point: | >230 °F |
| Melting_Point: | N/A |
| Product_Name: | 3-methoxycyclohexane-1-carboxylic acid |
| Symbol: | GHS07 |
| Bolling_Point: | 140-142ºC5 mm Hg(lit.) |
| FW: | 158.19500 |
| Density: | 1.087 g/mL at 25ºC(lit.) |
|---|---|
| MF: | C8H14O3 |
| LogP: | 1.27620 |
| Exact_Mass: | 158.09400 |
| Bolling_Point: | 140-142ºC5 mm Hg(lit.) |
| Flash_Point: | >230 °F |
| FW: | 158.19500 |
| Refractive_Index: | n20/D 1.4683(lit.) |
| PSA: | 46.53000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | H315-H319-H335 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Hazard_Codes: | Xi |
| HS_Code: | 2918990090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)