3-bromo-1-methyl-1,2,4-triazole
Catalog No: FT-0730057
CAS No: 56616-91-2
- Chemical Name: 3-bromo-1-methyl-1,2,4-triazole
- Molecular Formula: C3H4BrN3
- Molecular Weight: 161.99
- InChI Key: KWGLUDZPAMFWJZ-UHFFFAOYSA-N
- InChI: InChI=1S/C3H4BrN3/c1-7-2-5-3(4)6-7/h2H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 161.98800 |
|---|---|
| CAS: | 56616-91-2 |
| Flash_Point: | 108.5ºC |
| MF: | C3H4BrN3 |
| Symbol: | Warning |
| Bolling_Point: | 255.9ºC at 760mmHg |
| Melting_Point: | N/A |
| Product_Name: | 3-Bromo-1-methyl-1H-1,2,4-triazole |
| Density: | 1.93g/cm3 |
| FW: | 161.98800 |
|---|---|
| MF: | C3H4BrN3 |
| Exact_Mass: | 160.95900 |
| Flash_Point: | 108.5ºC |
| LogP: | 0.57760 |
| PSA: | 30.71000 |
| Refractive_Index: | 1.669 |
| Bolling_Point: | 255.9ºC at 760mmHg |
| Density: | 1.93g/cm3 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H315-H319-H335 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P305 + P351 + P338 |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)