2-(benzoyloxymethyl)benzoic acid
Catalog No: FT-0729576
CAS No: 58249-83-5
- Chemical Name: 2-(benzoyloxymethyl)benzoic acid
- Molecular Formula: C15H12O4
- Molecular Weight: 256.25
- InChI Key: QDENBWUYSUBCID-UHFFFAOYSA-N
- InChI: InChI=1S/C15H12O4/c16-14(17)13-9-5-4-8-12(13)10-19-15(18)11-6-2-1-3-7-11/h1-9H,10H2,(H,16,17)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 58249-83-5 |
| Flash_Point: | 160.8ºC |
| Product_Name: | 2-(benzoyloxymethyl)benzoic acid |
| Bolling_Point: | 425ºC at 760 mmHg |
| FW: | 256.25300 |
| Melting_Point: | 126-129ºC |
| MF: | C15H12O4 |
| Density: | 1.277g/cm3 |
| Melting_Point: | 126-129ºC |
|---|---|
| FW: | 256.25300 |
| Refractive_Index: | 1.609 |
| MF: | C15H12O4 |
| Exact_Mass: | 256.07400 |
| LogP: | 2.74180 |
| Bolling_Point: | 425ºC at 760 mmHg |
| Density: | 1.277g/cm3 |
| PSA: | 63.60000 |
| Flash_Point: | 160.8ºC |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | 36/37/38 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2918990090 |
| Hazard_Codes: | Xi |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)