2-(6-chloro-1H-benzimidazol-2-yl)ethanol
Catalog No: FT-0728110
CAS No: 20033-00-5
- Chemical Name: 2-(6-chloro-1H-benzimidazol-2-yl)ethanol
- Molecular Formula: C9H9ClN2O
- Molecular Weight: 196.63
- InChI Key: IZTRYOXAYPCDAP-UHFFFAOYSA-N
- InChI: InChI=1S/C9H9ClN2O/c10-6-1-2-7-8(5-6)12-9(11-7)3-4-13/h1-2,5,13H,3-4H2,(H,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 20033-00-5 |
|---|---|
| MF: | C9H9ClN2O |
| Density: | 1.431g/cm3 |
| Flash_Point: | 231.6ºC |
| Melting_Point: | N/A |
| Product_Name: | 2-(6-Chloro-1H-benzimidazol-2-yl)ethanol |
| Symbol: | GHS05 |
| Bolling_Point: | 459.3ºC at 760 mmHg |
| FW: | 196.63400 |
| Bolling_Point: | 459.3ºC at 760 mmHg |
|---|---|
| Density: | 1.431g/cm3 |
| MF: | C9H9ClN2O |
| LogP: | 1.75110 |
| Exact_Mass: | 196.04000 |
| Vapor_Pressure: | 3.12E-09mmHg at 25°C |
| Flash_Point: | 231.6ºC |
| FW: | 196.63400 |
| Refractive_Index: | 1.691 |
| PSA: | 48.91000 |
| Safety_Statements: | H318 |
|---|---|
| Symbol: | GHS05 |
| Warning_Statement: | P280-P305 + P351 + P338 |
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)