![methyl 5-chloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate (CAS: 1015609-99-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0723119.png "methyl 5-chloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate chemical structure")
methyl 5-chloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate
Catalog No: FT-0723119
CAS No: 1015609-99-0
- Chemical Name: methyl 5-chloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate
- Molecular Formula: C9H7ClN2O2
- Molecular Weight: 210.62
- InChI Key: FTEPMPLHLRLOQI-UHFFFAOYSA-N
- InChI: InChI=1S/C9H7ClN2O2/c1-14-9(13)7-5-2-3-11-8(5)12-4-6(7)10/h2-4H,1H3,(H,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 1015609-99-0 |
|---|---|
| MF: | C9H7ClN2O2 |
| Density: | 1.5±0.1 g/cm3 |
| Flash_Point: | 165.3±26.5 °C |
| Melting_Point: | N/A |
| Product_Name: | Methyl 5-chloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate |
| Symbol: | GHS07 |
| Bolling_Point: | 349.7±37.0 °C at 760 mmHg |
| FW: | 210.617 |
| Bolling_Point: | 349.7±37.0 °C at 760 mmHg |
|---|---|
| Density: | 1.5±0.1 g/cm3 |
| MF: | C9H7ClN2O2 |
| LogP: | 2.81 |
| Exact_Mass: | 210.019608 |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Flash_Point: | 165.3±26.5 °C |
| FW: | 210.617 |
| Refractive_Index: | 1.657 |
| PSA: | 54.98000 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 |
