N-(3-methylphenyl)-4-pyridin-4-yl-1,3-thiazol-2-amine
Catalog No: FT-0719423
CAS No: 315702-99-9
- Chemical Name: N-(3-methylphenyl)-4-pyridin-4-yl-1,3-thiazol-2-amine
- Molecular Formula: C15H13N3S
- Molecular Weight: 267.4
- InChI Key: KATNUHQNJGNLPW-UHFFFAOYSA-N
- InChI: InChI=1S/C15H13N3S/c1-11-3-2-4-13(9-11)17-15-18-14(10-19-15)12-5-7-16-8-6-12/h2-10H,1H3,(H,17,18)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 315702-99-9 |
|---|---|
| MF: | C15H13N3S |
| Density: | 1.3±0.1 g/cm3 |
| Flash_Point: | 222.8±29.3 °C |
| Melting_Point: | N/A |
| Product_Name: | STF-62247 |
| Symbol: | GHS07 |
| Bolling_Point: | 444.8±47.0 °C at 760 mmHg |
| FW: | 267.349 |
| Bolling_Point: | 444.8±47.0 °C at 760 mmHg |
|---|---|
| Density: | 1.3±0.1 g/cm3 |
| MF: | C15H13N3S |
| LogP: | 3.16 |
| Exact_Mass: | 267.083008 |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| Flash_Point: | 222.8±29.3 °C |
| FW: | 267.349 |
| Refractive_Index: | 1.671 |
| PSA: | 66.05000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|---|
| Safety_Statements: | H302-H319 |
| Warning_Statement: | P305 + P351 + P338 |
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)