![2-chloro-3-methyl-1H-pyrrolo[2,3-b]pyridine (CAS: 145934-57-2) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0718416.png "2-chloro-3-methyl-1H-pyrrolo[2,3-b]pyridine chemical structure")
2-chloro-3-methyl-1H-pyrrolo[2,3-b]pyridine
Catalog No: FT-0718416
CAS No: 145934-57-2
- Chemical Name: 2-chloro-3-methyl-1H-pyrrolo[2,3-b]pyridine
- Molecular Formula: C8H7ClN2
- Molecular Weight: 166.61
- InChI Key: ACPYFEOHCDNPLJ-UHFFFAOYSA-N
- InChI: InChI=1S/C8H7ClN2/c1-5-6-3-2-4-10-8(6)11-7(5)9/h2-4H,1H3,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 145934-57-2 |
|---|---|
| MF: | C8H7ClN2 |
| Density: | 1.4±0.1 g/cm3 |
| Flash_Point: | 174.1±12.1 °C |
| Melting_Point: | N/A |
| Product_Name: | 2-Chloro-3-methyl-7-azaindole |
| Symbol: | GHS05, GHS06 |
| Bolling_Point: | 315.9±37.0 °C at 760 mmHg |
| FW: | 166.608 |
| Bolling_Point: | 315.9±37.0 °C at 760 mmHg |
|---|---|
| Density: | 1.4±0.1 g/cm3 |
| MF: | C8H7ClN2 |
| LogP: | 3.33 |
| Exact_Mass: | 166.029770 |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Flash_Point: | 174.1±12.1 °C |
| FW: | 166.608 |
| Refractive_Index: | 1.675 |
| PSA: | 28.68000 |
| Safety_Statements: | H301-H315-H318-H335 |
|---|---|
| Symbol: | GHS05, GHS06 |
| Warning_Statement: | P261-P280-P301 + P310-P305 + P351 + P338 |
| HS_Code: | 2933990090 |
| RIDADR: | UN 2811 6.1 / PGIII |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)