![1-[(3,4-dimethylphenyl)methyl]piperazin-2-one (CAS: 938458-92-5) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0718329.png "1-[(3,4-dimethylphenyl)methyl]piperazin-2-one chemical structure")
1-[(3,4-dimethylphenyl)methyl]piperazin-2-one
Catalog No: FT-0718329
CAS No: 938458-92-5
- Chemical Name: 1-[(3,4-dimethylphenyl)methyl]piperazin-2-one
- Molecular Formula: C13H18N2O
- Molecular Weight: 218.29
- InChI Key: JDQLCQPPLOATHR-UHFFFAOYSA-N
- InChI: InChI=1S/C13H18N2O/c1-10-3-4-12(7-11(10)2)9-15-6-5-14-8-13(15)16/h3-4,7,14H,5-6,8-9H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 409.5ºC at 760 mmHg |
|---|---|
| CAS: | 938458-92-5 |
| MF: | C13H18N2O |
| Density: | 1.086g/cm3 |
| Melting_Point: | N/A |
| Product_Name: | 1-[(3,4-dimethylphenyl)methyl]piperazin-2-one |
| Flash_Point: | 201.5ºC |
| FW: | 218.29500 |
| Density: | 1.086g/cm3 |
|---|---|
| MF: | C13H18N2O |
| LogP: | 1.50190 |
| Exact_Mass: | 218.14200 |
| Bolling_Point: | 409.5ºC at 760 mmHg |
| Flash_Point: | 201.5ºC |
| FW: | 218.29500 |
| Refractive_Index: | 1.553 |
| PSA: | 32.34000 |
| HS_Code: | 2933599090 |
|---|---|
| RIDADR: | NONH for all modes of transport |
