2-(carbamoylamino)-5-(4-fluorophenyl)thiophene-3-carboxamide
Catalog No: FT-0715683
CAS No: 507475-17-4
- Chemical Name: 2-(carbamoylamino)-5-(4-fluorophenyl)thiophene-3-carboxamide
- Molecular Formula: C12H10FN3O2S
- Molecular Weight: 279.29
- InChI Key: SAYGKHKXGCPTLX-UHFFFAOYSA-N
- InChI: InChI=1S/C12H10FN3O2S/c13-7-3-1-6(2-4-7)9-5-8(10(14)17)11(19-9)16-12(15)18/h1-5H,(H2,14,17)(H3,15,16,18)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 507475-17-4 |
|---|---|
| MF: | C12H10FN3O2S |
| Density: | 1.5±0.1 g/cm3 |
| Flash_Point: | 221.5±28.7 °C |
| Melting_Point: | N/A |
| Product_Name: | TPCA-1 |
| Symbol: | GHS07 |
| Bolling_Point: | 442.6±45.0 °C at 760 mmHg |
| FW: | 279.290 |
| Bolling_Point: | 442.6±45.0 °C at 760 mmHg |
|---|---|
| Density: | 1.5±0.1 g/cm3 |
| MF: | C12H10FN3O2S |
| LogP: | 2.72 |
| Exact_Mass: | 279.047760 |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| Flash_Point: | 221.5±28.7 °C |
| FW: | 279.290 |
| Refractive_Index: | 1.686 |
| PSA: | 126.45000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | 26 |
| Warning_Statement: | P301 + P312 + P330-P305 + P351 + P338 |
| Hazard_Codes: | Xn |
| Risk_Statements(EU): | 22-36 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)