4-bromo-1-methylindole
Catalog No: FT-0714578
CAS No: 590417-55-3
- Chemical Name: 4-bromo-1-methylindole
- Molecular Formula: C9H8BrN
- Molecular Weight: 210.07
- InChI Key: JZOSXTYDJPHXQD-UHFFFAOYSA-N
- InChI: InChI=1S/C9H8BrN/c1-11-6-5-7-8(10)3-2-4-9(7)11/h2-6H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 590417-55-3 |
|---|---|
| MF: | C9H8BrN |
| Density: | 1.472g/cm3 |
| Flash_Point: | 135.766ºC |
| Melting_Point: | N/A |
| Product_Name: | 4-bromo-1-methylindole |
| Symbol: | GHS07 |
| Bolling_Point: | 300.878ºC at 760 mmHg |
| FW: | 210.07100 |
| Density: | 1.472g/cm3 |
|---|---|
| MF: | C9H8BrN |
| LogP: | 2.94080 |
| Exact_Mass: | 208.98400 |
| Bolling_Point: | 300.878ºC at 760 mmHg |
| Flash_Point: | 135.766ºC |
| FW: | 210.07100 |
| Refractive_Index: | 1.622 |
| PSA: | 4.93000 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302-H319 |
| Warning_Statement: | P305 + P351 + P338 |
| Hazard_Codes: | Xi |
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)