![2-[3,5-bis(carboxymethyl)phenyl]acetic acid (CAS: 4435-67-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0708414.png "2-[3,5-bis(carboxymethyl)phenyl]acetic acid chemical structure")
2-[3,5-bis(carboxymethyl)phenyl]acetic acid
Catalog No: FT-0708414
CAS No: 4435-67-0
- Chemical Name: 2-[3,5-bis(carboxymethyl)phenyl]acetic acid
- Molecular Formula: C12H12O6
- Molecular Weight: 252.22
- InChI Key: AJEIBHNKBLRDNT-UHFFFAOYSA-N
- InChI: InChI=1S/C12H12O6/c13-10(14)4-7-1-8(5-11(15)16)3-9(2-7)6-12(17)18/h1-3H,4-6H2,(H,13,14)(H,15,16)(H,17,18)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 4435-67-0 |
| Flash_Point: | 291ºC |
| Product_Name: | 1,3,5-tris(carboxymethyl)benzene |
| Bolling_Point: | 534.2ºC at 760mmHg |
| FW: | 252.22000 |
| Melting_Point: | N/A |
| MF: | C12H12O6 |
| Density: | 1.468g/cm3 |
| FW: | 252.22000 |
|---|---|
| Refractive_Index: | 1.61 |
| MF: | C12H12O6 |
| Exact_Mass: | 252.06300 |
| LogP: | 0.56790 |
| Bolling_Point: | 534.2ºC at 760mmHg |
| Density: | 1.468g/cm3 |
| PSA: | 111.90000 |
| Flash_Point: | 291ºC |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | 36/37/38 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
| HS_Code: | 2917399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)