![[1-(5-bromo-3-nitropyridin-2-yl)pyrrolidin-3-yl]methanol (CAS: 1138444-02-6) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0705663.png "[1-(5-bromo-3-nitropyridin-2-yl)pyrrolidin-3-yl]methanol chemical structure")
[1-(5-bromo-3-nitropyridin-2-yl)pyrrolidin-3-yl]methanol
Catalog No: FT-0705663
CAS No: 1138444-02-6
- Chemical Name: [1-(5-bromo-3-nitropyridin-2-yl)pyrrolidin-3-yl]methanol
- Molecular Formula: C10H12BrN3O3
- Molecular Weight: 302.12
- InChI Key: HDLFBYXQADTACU-UHFFFAOYSA-N
- InChI: InChI=1S/C10H12BrN3O3/c11-8-3-9(14(16)17)10(12-4-8)13-2-1-7(5-13)6-15/h3-4,7,15H,1-2,5-6H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 1138444-02-6 |
|---|---|
| MF: | C10H12BrN3O3 |
| Density: | N/A |
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | [1-(5-bromo-3-nitropyridin-2-yl)pyrrolidin-3-yl]methanol |
| Symbol: | GHS05, GHS07 |
| Bolling_Point: | N/A |
| FW: | 302.12500 |
| Exact_Mass: | 301.00600 |
|---|---|
| MF: | C10H12BrN3O3 |
| LogP: | 2.15910 |
| PSA: | 82.18000 |
| FW: | 302.12500 |
| Safety_Statements: | H302-H318 |
|---|---|
| Symbol: | GHS05, GHS07 |
| Warning_Statement: | P280-P305 + P351 + P338 |
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
