![3,5-dihydro-2H-[1,4]dioxino[2,3-b]pyridin-8-one (CAS: 1246088-43-6) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0703188.png "3,5-dihydro-2H-[1,4]dioxino[2,3-b]pyridin-8-one chemical structure")
3,5-dihydro-2H-[1,4]dioxino[2,3-b]pyridin-8-one
Catalog No: FT-0703188
CAS No: 1246088-43-6
- Chemical Name: 3,5-dihydro-2H-[1,4]dioxino[2,3-b]pyridin-8-one
- Molecular Formula: C7H7NO3
- Molecular Weight: 153.14
- InChI Key: SXRLRBBARNJINI-UHFFFAOYSA-N
- InChI: InChI=1S/C7H7NO3/c9-5-1-2-8-7-6(5)10-3-4-11-7/h1-2H,3-4H2,(H,8,9)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | N/A |
|---|---|
| CAS: | 1246088-43-6 |
| MF: | C7H7NO3 |
| Density: | N/A |
| Melting_Point: | N/A |
| Product_Name: | 2,3-Dihydro-[1,4]dioxino[2,3-b]pyridin-8-ol |
| Flash_Point: | N/A |
| FW: | 153.13500 |
| Exact_Mass: | 153.04300 |
|---|---|
| MF: | C7H7NO3 |
| LogP: | 0.55840 |
| PSA: | 51.58000 |
| FW: | 153.13500 |
| HS_Code: | 2934999090 |
|---|---|
| RIDADR: | NONH for all modes of transport |
