sodium;(2S)-2-(dodecanoylamino)-5-hydroxy-5-oxopentanoate
Catalog No: FT-0700069
CAS No: 29923-31-7
- Chemical Name: sodium;(2S)-2-(dodecanoylamino)-5-hydroxy-5-oxopentanoate
- Molecular Formula: C17H30NNaO5
- Molecular Weight: 351.4
- InChI Key: IWIUXJGIDSGWDN-UQKRIMTDSA-M
- InChI: InChI=1S/C17H31NO5.Na/c1-2-3-4-5-6-7-8-9-10-11-15(19)18-14(17(22)23)12-13-16(20)21;/h14H,2-13H2,1H3,(H,18,19)(H,20,21)(H,22,23);/q;+1/p-1/t14-;/m0./s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 29923-31-7 |
|---|---|
| MF: | C17H30NNaO5 |
| Density: | N/A |
| Flash_Point: | 282.6ºC |
| Melting_Point: | N/A |
| Product_Name: | sodium,(2S)-2-(dodecanoylamino)-5-hydroxy-5-oxopentanoate |
| Symbol: | GHS07 |
| Bolling_Point: | 543.6ºC at 760 mmHg |
| FW: | 350.406 |
| MF: | C17H30NNaO5 |
|---|---|
| LogP: | 2.39770 |
| Exact_Mass: | 350.194885 |
| Bolling_Point: | 543.6ºC at 760 mmHg |
| Flash_Point: | 282.6ºC |
| FW: | 350.406 |
| PSA: | 106.53000 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H319 |
| Warning_Statement: | P280-P305 + P351 + P338-P337 + P313 |
| Hazard_Codes: | Xi:Irritant; |
| HS_Code: | 2924199090 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R36 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)