![4-methoxy-2-[(E)-2-phenylethenyl]-2,3-dihydropyran-6-one (CAS: 3155-48-4) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0700030.png "4-methoxy-2-[(E)-2-phenylethenyl]-2,3-dihydropyran-6-one chemical structure")
4-methoxy-2-[(E)-2-phenylethenyl]-2,3-dihydropyran-6-one
Catalog No: FT-0700030
CAS No: 3155-48-4
- Chemical Name: 4-methoxy-2-[(E)-2-phenylethenyl]-2,3-dihydropyran-6-one
- Molecular Formula: C14H14O3
- Molecular Weight: 230.26
- InChI Key: XEAQIWGXBXCYFX-BQYQJAHWSA-N
- InChI: InChI=1S/C14H14O3/c1-16-13-9-12(17-14(15)10-13)8-7-11-5-3-2-4-6-11/h2-8,10,12H,9H2,1H3/b8-7+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 3155-48-4 |
|---|---|
| MF: | C14H14O3 |
| Density: | 1.2±0.1 g/cm3 |
| Flash_Point: | 184.6±23.3 °C |
| Melting_Point: | 142-148ºC |
| Product_Name: | Kavain |
| Symbol: | GHS07 |
| Bolling_Point: | 432.6±45.0 °C at 760 mmHg |
| FW: | 230.259 |
| Bolling_Point: | 432.6±45.0 °C at 760 mmHg |
|---|---|
| Density: | 1.2±0.1 g/cm3 |
| MF: | C14H14O3 |
| LogP: | 1.69 |
| Melting_Point: | 142-148ºC |
| Exact_Mass: | 230.094299 |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Flash_Point: | 184.6±23.3 °C |
| FW: | 230.259 |
| Refractive_Index: | 1.565 |
| PSA: | 35.53000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | GHS07 |
| Hazard_Codes: | Xn:Harmful; |
| Risk_Statements(EU): | R22 |
| RIDADR: | NONH for all modes of transport |
