![1-[4-(methylamino)phenyl]ethanone (CAS: 17687-47-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0699647.png "1-[4-(methylamino)phenyl]ethanone chemical structure")
1-[4-(methylamino)phenyl]ethanone
Catalog No: FT-0699647
CAS No: 17687-47-7
- Chemical Name: 1-[4-(methylamino)phenyl]ethanone
- Molecular Formula: C9H11NO
- Molecular Weight: 149.19
- InChI Key: GDBAYICEBDZUNM-UHFFFAOYSA-N
- InChI: InChI=1S/C9H11NO/c1-7(11)8-3-5-9(10-2)6-4-8/h3-6,10H,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 17687-47-7 |
|---|---|
| MF: | C9H11NO |
| Density: | 1.1±0.1 g/cm3 |
| Flash_Point: | 125.8±22.8 °C |
| Melting_Point: | 103-107ºC |
| Product_Name: | 1-[4-(Methylamino)phenyl]ethanone |
| Symbol: | GHS07 |
| Bolling_Point: | 281.7±23.0 °C at 760 mmHg |
| FW: | 149.190 |
| Bolling_Point: | 281.7±23.0 °C at 760 mmHg |
|---|---|
| Density: | 1.1±0.1 g/cm3 |
| MF: | C9H11NO |
| LogP: | 1.48 |
| Melting_Point: | 103-107ºC |
| Exact_Mass: | 149.084061 |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Flash_Point: | 125.8±22.8 °C |
| FW: | 149.190 |
| Refractive_Index: | 1.567 |
| PSA: | 29.10000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | S36/37 |
| Warning_Statement: | P280 |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2922399090 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R43 |
