Valylserine
Catalog No: FT-0695355
CAS No: 13588-94-8
- Chemical Name: Valylserine
- Molecular Formula: C8H16N2O4
- Molecular Weight: 204.22
- InChI Key: STTYIMSDIYISRG-WDSKDSINSA-N
- InChI: InChI=1S/C8H16N2O4/c1-4(2)6(9)7(12)10-5(3-11)8(13)14/h4-6,11H,3,9H2,1-2H3,(H,10,12)(H,13,14)/t5-,6-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 13588-94-8 |
| Flash_Point: | 238.8ºC |
| Product_Name: | Val-Ser |
| Bolling_Point: | 471.2ºC at 760mmHg |
| FW: | 204.22400 |
| Melting_Point: | N/A |
| MF: | C8H16N2O4 |
| Density: | 1.249g/cm3 |
| Refractive_Index: | 1.514 |
|---|---|
| Vapor_Pressure: | 7.35E-11mmHg at 25°C |
| MF: | C8H16N2O4 |
| Flash_Point: | 238.8ºC |
| FW: | 204.22400 |
| Density: | 1.249g/cm3 |
| PSA: | 112.65000 |
| Bolling_Point: | 471.2ºC at 760mmHg |
| Exact_Mass: | 204.11100 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2924199090 |
| WGK_Germany: | 3 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)