N-Ethylacrylamide
Catalog No: FT-0695176
CAS No: 5883-17-0
- Chemical Name: N-Ethylacrylamide
- Molecular Formula: C5H9NO
- Molecular Weight: 99.13
- InChI Key: SWPMNMYLORDLJE-UHFFFAOYSA-N
- InChI: InChI=1S/C5H9NO/c1-3-5(7)6-4-2/h3H,1,4H2,2H3,(H,6,7)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 99.131 |
| Density: | 0.9±0.1 g/cm3 |
| CAS: | 5883-17-0 |
| Bolling_Point: | 219.8±13.0 °C at 760 mmHg |
| Product_Name: | N-Ethylacrylamide |
| Melting_Point: | N/A |
| Flash_Point: | 114.1±4.8 °C |
| MF: | C5H9NO |
| Density: | 0.9±0.1 g/cm3 |
|---|---|
| LogP: | -0.15 |
| Flash_Point: | 114.1±4.8 °C |
| Refractive_Index: | 1.423 |
| FW: | 99.131 |
| PSA: | 29.10000 |
| MF: | C5H9NO |
| Bolling_Point: | 219.8±13.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.1±0.4 mmHg at 25°C |
| Exact_Mass: | 99.068413 |
| Risk_Statements(EU): | 20/21/22-36/37/38 |
|---|---|
| Safety_Statements: | 26-36 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P301 + P312 + P330 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)