3,3-Dimethyl-1-{[5-(2-naphthyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-2-butanone
Catalog No: FT-0694578
CAS No: 5315-73-1
- Chemical Name: 3,3-Dimethyl-1-{[5-(2-naphthyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-2-butanone
- Molecular Formula: C7H5ClN2
- Molecular Weight: 152.58
- InChI Key: DZHPZIQQEVQDEJ-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5ClN2/c8-6-5-9-7-3-1-2-4-10(6)7/h1-5H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 152.58100 |
| Density: | 1.25g/cm3 |
| CAS: | 5315-73-1 |
| Bolling_Point: | 493.2ºC at 760mmHg |
| Product_Name: | imidazo[1,2-a]pyridine, 3-chloro |
| Melting_Point: | N/A |
| Flash_Point: | 252.1ºC |
| MF: | C7H5ClN2 |
| Density: | 1.25g/cm3 |
|---|---|
| LogP: | 1.98770 |
| Flash_Point: | 252.1ºC |
| Refractive_Index: | 1.631 |
| FW: | 152.58100 |
| PSA: | 17.30000 |
| MF: | C7H5ClN2 |
| Bolling_Point: | 493.2ºC at 760mmHg |
| Exact_Mass: | 152.01400 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)