(2E)-3-(4-Chlorphenyl)prop-2-enal
Catalog No: FT-0694153
CAS No: 49678-02-6
- Chemical Name: (2E)-3-(4-Chlorphenyl)prop-2-enal
- Molecular Formula: C9H7ClO
- Molecular Weight: 166.60
- InChI Key: HONRSHHPFBMLBT-OWOJBTEDSA-N
- InChI: InChI=1S/C9H7ClO/c10-9-5-3-8(4-6-9)2-1-7-11/h1-7H/b2-1+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 166.604 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 49678-02-6 |
| Bolling_Point: | 290.4±15.0 °C at 760 mmHg |
| Product_Name: | (2E)-3-(4-Chlorphenyl)prop-2-enal |
| Melting_Point: | N/A |
| Flash_Point: | 134.6±11.5 °C |
| MF: | C9H7ClO |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 2.65 |
| Flash_Point: | 134.6±11.5 °C |
| Refractive_Index: | 1.591 |
| FW: | 166.604 |
| PSA: | 17.07000 |
| MF: | C9H7ClO |
| Bolling_Point: | 290.4±15.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 166.018539 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H315-H317-H319 |
| Symbol: | Warning |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)