![N-Cyclohexylcyclohexanaminium (2R)-2-[(tert-butoxycarbonyl)amino]butanoate (CAS: 27494-47-9) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0693722.png "N-Cyclohexylcyclohexanaminium (2R)-2-[(tert-butoxycarbonyl)amino]butanoate chemical structure")
N-Cyclohexylcyclohexanaminium (2R)-2-[(tert-butoxycarbonyl)amino]butanoate
Catalog No: FT-0693722
CAS No: 27494-47-9
- Chemical Name: N-Cyclohexylcyclohexanaminium (2R)-2-[(tert-butoxycarbonyl)amino]butanoate
- Molecular Formula: C21H40N2O4
- Molecular Weight: 384.6
- InChI Key: HOSMYZXDFVUSCV-FCXZQVPUSA-N
- InChI: InChI=1S/C12H23N.C9H17NO4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-6(7(11)12)10-8(13)14-9(2,3)4/h11-13H,1-10H2;6H,5H2,1-4H3,(H,10,13)(H,11,12)/t;6-/m.1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | Boc-D-Abu-OH.DCHA |
|---|---|
| Flash_Point: | 156.1ºC |
| Melting_Point: | N/A |
| FW: | 384.55300 |
| Density: | N/A |
| CAS: | 27494-47-9 |
| Bolling_Point: | 334.5ºC at 760 mmHg |
| MF: | C21H40N2O4 |
| LogP: | 5.39750 |
|---|---|
| Flash_Point: | 156.1ºC |
| FW: | 384.55300 |
| PSA: | 87.66000 |
| MF: | C21H40N2O4 |
| Bolling_Point: | 334.5ºC at 760 mmHg |
| Vapor_Pressure: | 2.42E-05mmHg at 25°C |
| Exact_Mass: | 384.29900 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2924299090 |
| WGK_Germany: | 3 |
