1-Adamantanethiol
Catalog No: FT-0690958
CAS No: 34301-54-7
- Chemical Name: 1-Adamantanethiol
- Molecular Formula: C10H16S
- Molecular Weight: 168.3
- InChI Key: ADJJLNODXLXTIH-UHFFFAOYSA-N
- InChI: InChI=1S/C10H16S/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9,11H,1-6H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 168.29900 |
|---|---|
| CAS: | 34301-54-7 |
| Flash_Point: | 94.2ºC |
| MF: | C10H16S |
| Symbol: | Danger |
| Bolling_Point: | 237.8ºC at 760mmHg |
| Melting_Point: | 99-106ºC |
| Product_Name: | 1-Adamantanethiol |
| Density: | 1.09g/cm3 |
| FW: | 168.29900 |
|---|---|
| MF: | C10H16S |
| Exact_Mass: | 168.09700 |
| Flash_Point: | 94.2ºC |
| LogP: | 2.88500 |
| PSA: | 38.80000 |
| Refractive_Index: | 1.562 |
| Bolling_Point: | 237.8ºC at 760mmHg |
| Melting_Point: | 99-106ºC |
| Density: | 1.09g/cm3 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|---|
| Symbol: | GHS06 |
| Warning_Statement: | P301 + P310-P305 + P351 + P338 |
| Safety_Statements: | H301-H319 |
| RIDADR: | UN 2811 6.1/PG 3 |
| Risk_Statements(EU): | 25-36-51/53 |
| Hazard_Codes: | T: Toxic;N: Dangerous for the environment; |
| HS_Code: | 2930909090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)