![Potassium oxo(1H-pyrrolo[2,3-b]pyridin-3-yl)acetate (CAS: 357263-59-3) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0688236.webp "Potassium oxo(1H-pyrrolo[2,3-b]pyridin-3-yl)acetate chemical structure")
Potassium oxo(1H-pyrrolo[2,3-b]pyridin-3-yl)acetate
Catalog No: FT-0688236
CAS No: 357263-59-3
- Chemical Name: Potassium oxo(1H-pyrrolo[2,3-b]pyridin-3-yl)acetate
- Molecular Formula: C9H5KN2O3
- Molecular Weight: 228.25 g/mol
- InChI Key: YIQLVLNMGQKIES-UHFFFAOYSA-M
- InChI: InChI=1S/C9H6N2O3.K/c12-7(9(13)14)6-4-11-8-5(6)2-1-3-10-8;/h1-4H,(H,10,11)(H,13,14);/q;+1/p-1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 228.24600 |
| Density: | N/A |
| CAS: | 357263-59-3 |
| Bolling_Point: | N/A |
| Product_Name: | potassium,2-oxo-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetate |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C9H5KN2O3 |
| PSA: | 85.88000 |
|---|---|
| MF: | C9H5KN2O3 |
| FW: | 228.24600 |
| Exact_Mass: | 227.99400 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
Related Products
Acetamide, N-[(6R)-6-amino-4,5,6,7-tetrahydro-2-benzothiazolyl]-
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-