9-ethylguanine
Catalog No: FT-0688014
CAS No: 879-08-3
- Chemical Name: 9-ethylguanine
- Molecular Formula: C7H9N5O
- Molecular Weight: 179.18
- InChI Key: WDOYBEPLTCFIRQ-UHFFFAOYSA-N
- InChI: InChI=1S/C7H9N5O/c1-2-12-3-9-4-5(12)10-7(8)11-6(4)13/h3H,2H2,1H3,(H3,8,10,11,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 486.1ºC at 760 mmHg |
|---|---|
| MF: | C7H9N5O |
| Density: | 1.68g/cm3 |
| FW: | 179.17900 |
| Product_Name: | 2-amino-9-ethyl-3H-purin-6-one |
| CAS: | 879-08-3 |
| Flash_Point: | 247.8ºC |
| Melting_Point: | N/A |
| Bolling_Point: | 486.1ºC at 760 mmHg |
|---|---|
| MF: | C7H9N5O |
| Density: | 1.68g/cm3 |
| Refractive_Index: | 1.798 |
| Exact_Mass: | 179.08100 |
| PSA: | 89.59000 |
| LogP: | 0.30290 |
| Flash_Point: | 247.8ºC |
| FW: | 179.17900 |
| HS_Code: | 2933990090 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| WGK_Germany: | 3 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)