![[2-(Bromomethyl)-4-fluorophenyl]boronic acid (CAS: 850568-01-3) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0687822.png "[2-(Bromomethyl)-4-fluorophenyl]boronic acid chemical structure")
[2-(Bromomethyl)-4-fluorophenyl]boronic acid
Catalog No: FT-0687822
CAS No: 850568-01-3
- Chemical Name: [2-(Bromomethyl)-4-fluorophenyl]boronic acid
- Molecular Formula: C7H7BBrFO2
- Molecular Weight: 232.84
- InChI Key: SAHGEZUSQVBFDM-UHFFFAOYSA-N
- InChI: InChI=1S/C7H7BBrFO2/c9-4-5-3-6(10)1-2-7(5)8(11)12/h1-3,11-12H,4H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | [2-(bromomethyl)-4-fluorophenyl]boronic acid |
|---|---|
| Flash_Point: | 161.3ºC |
| Melting_Point: | 169-171ºC |
| FW: | 232.84300 |
| Density: | 1.64g/cm3 |
| CAS: | 850568-01-3 |
| Bolling_Point: | 343.1ºC at 760 mmHg |
| MF: | C7H7BBrFO2 |
| Density: | 1.64g/cm3 |
|---|---|
| LogP: | 0.40040 |
| Flash_Point: | 161.3ºC |
| Melting_Point: | 169-171ºC |
| FW: | 232.84300 |
| PSA: | 40.46000 |
| Exact_Mass: | 231.97100 |
| MF: | C7H7BBrFO2 |
| Bolling_Point: | 343.1ºC at 760 mmHg |
| Refractive_Index: | 1.559 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| HS_Code: | 2931900090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)