![4-(5-CHLOROMETHYL-[1,2,4]OXADIAZOL-3-YL)-PHENOL (CAS: 5509-32-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0687243.png "4-(5-CHLOROMETHYL-[1,2,4]OXADIAZOL-3-YL)-PHENOL chemical structure")
4-(5-CHLOROMETHYL-[1,2,4]OXADIAZOL-3-YL)-PHENOL
Catalog No: FT-0687243
CAS No: 5509-32-0
- Chemical Name: 4-(5-CHLOROMETHYL-[1,2,4]OXADIAZOL-3-YL)-PHENOL
- Molecular Formula: C9H7ClN2O2
- Molecular Weight: 210.62
- InChI Key: XSMCWQFRZFCVAM-UHFFFAOYSA-N
- InChI: InChI=1S/C9H7ClN2O2/c10-5-8-11-9(12-14-8)6-1-3-7(13)4-2-6/h1-4,13H,5H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 4-[5-(chloromethyl)-1,2,4-oxadiazol-3-ylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| Flash_Point: | 187.2ºC |
| Melting_Point: | N/A |
| FW: | 210.61700 |
| Density: | 1.403g/cm3 |
| CAS: | 5509-32-0 |
| Bolling_Point: | 385.9ºC at 760mmHg |
| MF: | C9H7ClN2O2 |
| Density: | 1.403g/cm3 |
|---|---|
| LogP: | 2.18100 |
| Flash_Point: | 187.2ºC |
| Refractive_Index: | 1.594 |
| FW: | 210.61700 |
| PSA: | 59.15000 |
| MF: | C9H7ClN2O2 |
| Bolling_Point: | 385.9ºC at 760mmHg |
| Exact_Mass: | 210.02000 |
| HS_Code: | 2934999090 |
|---|
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)