Oxetane-3-carboxylic acid
Catalog No: FT-0684529
CAS No: 114012-41-8
- Chemical Name: Oxetane-3-carboxylic acid
- Molecular Formula: C4H6O3
- Molecular Weight: 102.09
- InChI Key: UWOTZNQZPLAURK-UHFFFAOYSA-N
- InChI: InChI=1S/C4H6O3/c5-4(6)3-1-7-2-3/h3H,1-2H2,(H,5,6)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 102.089 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 114012-41-8 |
| Bolling_Point: | 244.2±33.0 °C at 760 mmHg |
| Product_Name: | 3-Oxetanecarboxylic acid |
| Melting_Point: | N/A |
| Flash_Point: | 115.1±18.9 °C |
| MF: | C4H6O3 |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | -0.90 |
| Flash_Point: | 115.1±18.9 °C |
| Refractive_Index: | 1.492 |
| FW: | 102.089 |
| PSA: | 46.53000 |
| MF: | C4H6O3 |
| Bolling_Point: | 244.2±33.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Exact_Mass: | 102.031693 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2932999099 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)