1-(Hydroxymethyl)cyclobutanecarboxamide
Catalog No: FT-0684084
CAS No: 1123169-19-6
- Chemical Name: 1-(Hydroxymethyl)cyclobutanecarboxamide
- Molecular Formula: C6H11NO2
- Molecular Weight: 129.16
- InChI Key: FDUFONMKKOFOQH-UHFFFAOYSA-N
- InChI: InChI=1S/C6H11NO2/c7-5(9)6(4-8)2-1-3-6/h8H,1-4H2,(H2,7,9)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 129.15700 |
| Density: | N/A |
| CAS: | 1123169-19-6 |
| Bolling_Point: | N/A |
| Product_Name: | 1-(hydroxymethyl)cyclobutane-1-carboxamide |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C6H11NO2 |
| LogP: | 0.33460 |
|---|---|
| PSA: | 63.32000 |
| MF: | C6H11NO2 |
| FW: | 129.15700 |
| Exact_Mass: | 129.07900 |
| Warning_Statement: | P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2924299090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)