Ethyl aminohydroxyiminoacetate
Catalog No: FT-0682772
CAS No: 10489-74-4
- Chemical Name: Ethyl aminohydroxyiminoacetate
- Molecular Formula: C4H8N2O3
- Molecular Weight: 132.12
- InChI Key: QGYKRMZPOOILBA-UHFFFAOYSA-N
- InChI: InChI=1S/C4H8N2O3/c1-2-9-4(7)3(5)6-8/h8H,2H2,1H3,(H2,5,6)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 132.118 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 10489-74-4 |
| Bolling_Point: | 262.3±23.0 °C at 760 mmHg |
| Product_Name: | Ethyl (2E)-amino(hydroxyimino)acetate |
| Melting_Point: | 99-103ºC(lit.) |
| Flash_Point: | 112.4±22.6 °C |
| MF: | C4H8N2O3 |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 0.00 |
| Flash_Point: | 112.4±22.6 °C |
| Melting_Point: | 99-103ºC(lit.) |
| FW: | 132.118 |
| PSA: | 84.91000 |
| Exact_Mass: | 132.053497 |
| MF: | C4H8N2O3 |
| Bolling_Point: | 262.3±23.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.2 mmHg at 25°C |
| Refractive_Index: | 1.498 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi: Irritant; |
| Risk_Statements(EU): | 36/37/38 |
| Safety_Statements: | 26-36 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2925290090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)