3-Bromo-2-methoxybenzonitrile
Catalog No: FT-0682428
CAS No: 874472-98-7
- Chemical Name: 3-Bromo-2-methoxybenzonitrile
- Molecular Formula: C8H6BrNO
- Molecular Weight: 212.04
- InChI Key: ONHVKHDUTPBVBT-UHFFFAOYSA-N
- InChI: InChI=1S/C8H6BrNO/c1-11-8-6(5-10)3-2-4-7(8)9/h2-4H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 212.04300 |
| Density: | N/A |
| CAS: | 874472-98-7 |
| Bolling_Point: | N/A |
| Product_Name: | 3-Bromo-2-Methoxybenzonitrile |
| Melting_Point: | 75-78ºC |
| Flash_Point: | N/A |
| MF: | C8H6BrNO |
| LogP: | 2.32938 |
|---|---|
| Melting_Point: | 75-78ºC |
| FW: | 212.04300 |
| PSA: | 33.02000 |
| MF: | C8H6BrNO |
| Exact_Mass: | 210.96300 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R20/21/22 |
| Safety_Statements: | 36/37 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P280 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)