![7-Bromopyrido[3,2-d]pyrimidin-4-ol (CAS: 573675-29-3) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0681927.png "7-Bromopyrido[3,2-d]pyrimidin-4-ol chemical structure")
7-Bromopyrido[3,2-d]pyrimidin-4-ol
Catalog No: FT-0681927
CAS No: 573675-29-3
- Chemical Name: 7-Bromopyrido[3,2-d]pyrimidin-4-ol
- Molecular Formula: C7H4BrN3O
- Molecular Weight: 226.03
- InChI Key: NGLZIMDUQCALAS-UHFFFAOYSA-N
- InChI: InChI=1S/C7H4BrN3O/c8-4-1-5-6(9-2-4)7(12)11-3-10-5/h1-3H,(H,10,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 226.030 |
| Density: | 2.0±0.1 g/cm3 |
| CAS: | 573675-29-3 |
| Bolling_Point: | 455.3±30.0 °C at 760 mmHg |
| Product_Name: | 7-Bromopyrido[3,2-d]pyrimidin-4(3H)-one |
| Melting_Point: | N/A |
| Flash_Point: | 229.1±24.6 °C |
| MF: | C7H4BrN3O |
| Density: | 2.0±0.1 g/cm3 |
|---|---|
| LogP: | 0.30 |
| Flash_Point: | 229.1±24.6 °C |
| Refractive_Index: | 1.785 |
| FW: | 226.030 |
| PSA: | 58.90000 |
| MF: | C7H4BrN3O |
| Bolling_Point: | 455.3±30.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| Exact_Mass: | 224.953766 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
![1-[4-[(3,4-DICHLOROBENZYL)OXY]-3-NITROPHENYL]ETHAN-1-ONE (CAS: 175136-25-1) - Related Chemical Product](/static/img/prod_pic/FT-0607176.png "1-[4-[(3,4-DICHLOROBENZYL)OXY]-3-NITROPHENYL]ETHAN-1-ONE chemical structure")
![methyl 2-[2-nitro-4-(trifluoromethyl)phenyl]acetate (CAS: 13544-07-5) - Related Chemical Product](/static/img/prod_pic/FT-0764625.png "methyl 2-[2-nitro-4-(trifluoromethyl)phenyl]acetate chemical structure")
