N-(6-Chloro-4-pyrimidinyl)-N,N-dimethylamine
Catalog No: FT-0681421
CAS No: 31058-83-0
- Chemical Name: N-(6-Chloro-4-pyrimidinyl)-N,N-dimethylamine
- Molecular Formula: C6H8ClN3
- Molecular Weight: 157.60
- InChI Key: WAGVAZQFCOMORW-UHFFFAOYSA-N
- InChI: InChI=1S/C6H8ClN3/c1-10(2)6-3-5(7)8-4-9-6/h3-4H,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 157.601 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 31058-83-0 |
| Bolling_Point: | 271.4±20.0 °C at 760 mmHg |
| Product_Name: | 6-Chloro-N,N-dimethylpyrimidin-4-amine |
| Melting_Point: | N/A |
| Flash_Point: | 117.9±21.8 °C |
| MF: | C6H8ClN3 |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 1.74 |
| Flash_Point: | 117.9±21.8 °C |
| Refractive_Index: | 1.576 |
| FW: | 157.601 |
| PSA: | 29.02000 |
| MF: | C6H8ClN3 |
| Bolling_Point: | 271.4±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 157.040680 |
| Warning_Statement: | P280 |
|---|---|
| Safety_Statements: | H302-H317 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933599090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)