![2-[(6-Chloro-2-methyl-4-pyrimidinyl)amino]-1-ethanol (CAS: 22177-97-5) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0681236.png "2-[(6-Chloro-2-methyl-4-pyrimidinyl)amino]-1-ethanol chemical structure")
2-[(6-Chloro-2-methyl-4-pyrimidinyl)amino]-1-ethanol
Catalog No: FT-0681236
CAS No: 22177-97-5
- Chemical Name: 2-[(6-Chloro-2-methyl-4-pyrimidinyl)amino]-1-ethanol
- Molecular Formula: C7H10ClN3O
- Molecular Weight: 187.63
- InChI Key: ZGGCITTWLSUFPP-UHFFFAOYSA-N
- InChI: InChI=1S/C7H10ClN3O/c1-5-10-6(8)4-7(11-5)9-2-3-12/h4,12H,2-3H2,1H3,(H,9,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-[(6-chloro-2-methylpyrimidin-4-yl)amino]ethanol |
|---|---|
| Flash_Point: | 175.9ºC |
| Melting_Point: | 93-95ºC |
| FW: | 187.62700 |
| Density: | 1.363g/cm3 |
| CAS: | 22177-97-5 |
| Bolling_Point: | 367.2ºC at 760mmHg |
| MF: | C7H10ClN3O |
| Density: | 1.363g/cm3 |
|---|---|
| LogP: | 0.91560 |
| Flash_Point: | 175.9ºC |
| Melting_Point: | 93-95ºC |
| FW: | 187.62700 |
| PSA: | 58.04000 |
| Exact_Mass: | 187.05100 |
| MF: | C7H10ClN3O |
| Bolling_Point: | 367.2ºC at 760mmHg |
| Vapor_Pressure: | 4.87E-06mmHg at 25°C |
| Refractive_Index: | 1.613 |
| HS_Code: | 2933599090 |
|---|
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)