N-[4-(2-Amino-1,3-thiazol-4-yl)phenyl]acetamide
Catalog No: FT-0680848
CAS No: 21674-96-4
- Chemical Name: N-[4-(2-Amino-1,3-thiazol-4-yl)phenyl]acetamide
- Molecular Formula: C11H11N3OS
- Molecular Weight: 233.29
- InChI Key: VBBNSESFUHRMJU-UHFFFAOYSA-N
- InChI: InChI=1S/C11H11N3OS/c1-7(15)13-9-4-2-8(3-5-9)10-6-16-11(12)14-10/h2-6H,1H3,(H2,12,14)(H,13,15)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 21674-96-4 |
| Flash_Point: | 272.1ºC |
| Product_Name: | N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]acetamide |
| Bolling_Point: | 526.3ºC at 760mmHg |
| FW: | 233.29000 |
| Melting_Point: | 252-256ºC |
| MF: | C11H11N3OS |
| Density: | 1.35g/cm3 |
| Melting_Point: | 252-256ºC |
|---|---|
| Refractive_Index: | 1.687 |
| Vapor_Pressure: | 3.62E-11mmHg at 25°C |
| MF: | C11H11N3OS |
| Flash_Point: | 272.1ºC |
| LogP: | 3.00490 |
| FW: | 233.29000 |
| Density: | 1.35g/cm3 |
| PSA: | 96.25000 |
| Bolling_Point: | 526.3ºC at 760mmHg |
| Exact_Mass: | 233.06200 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | 22-36/37/38 |
| HS_Code: | 2934100090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn: Harmful; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)