4-Methoxy-1H-indazol-3-amine
Catalog No: FT-0680755
CAS No: 886362-07-8
- Chemical Name: 4-Methoxy-1H-indazol-3-amine
- Molecular Formula: C8H9N3O
- Molecular Weight: 163.18
- InChI Key: JZAMRGWQDJMEJD-UHFFFAOYSA-N
- InChI: InChI=1S/C8H9N3O/c1-12-6-4-2-3-5-7(6)8(9)11-10-5/h2-4H,1H3,(H3,9,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 163.177 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 886362-07-8 |
| Bolling_Point: | 406.3±25.0 °C at 760 mmHg |
| Product_Name: | 4-methoxy-1H-indazol-3-amine |
| Melting_Point: | 85-87ºC |
| Flash_Point: | 199.5±23.2 °C |
| MF: | C8H9N3O |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 1.12 |
| Flash_Point: | 199.5±23.2 °C |
| Melting_Point: | 85-87ºC |
| FW: | 163.177 |
| PSA: | 63.93000 |
| Exact_Mass: | 163.074554 |
| MF: | C8H9N3O |
| Bolling_Point: | 406.3±25.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| Refractive_Index: | 1.712 |
| Hazard_Codes: | Xi |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)