Imidazo[1,2-a]pyridine-6-carbonitrile
Catalog No: FT-0680703
CAS No: 106850-34-4
- Chemical Name: Imidazo[1,2-a]pyridine-6-carbonitrile
- Molecular Formula: C8H5N3
- Molecular Weight: 143.15
- InChI Key: LRJOKNYELSECDZ-UHFFFAOYSA-N
- InChI: InChI=1S/C8H5N3/c9-5-7-1-2-8-10-3-4-11(8)6-7/h1-4,6H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 143.14500 |
| Density: | 1.22g/cm3 |
| CAS: | 106850-34-4 |
| Bolling_Point: | N/A |
| Product_Name: | Imidazo[1,2-a]pyridine-6-carbonitrile |
| Melting_Point: | 160-163ºC |
| Flash_Point: | N/A |
| MF: | C8H5N3 |
| Melting_Point: | 160-163ºC |
|---|---|
| Density: | 1.22g/cm3 |
| LogP: | 1.20598 |
| Refractive_Index: | 1.664 |
| FW: | 143.14500 |
| PSA: | 41.09000 |
| MF: | C8H5N3 |
| Exact_Mass: | 143.04800 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)