![{1-[(Methylamino)methyl]cyclobutyl}methanol (CAS: 180205-31-6) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0679647.png "{1-[(Methylamino)methyl]cyclobutyl}methanol chemical structure")
{1-[(Methylamino)methyl]cyclobutyl}methanol
Catalog No: FT-0679647
CAS No: 180205-31-6
- Chemical Name: {1-[(Methylamino)methyl]cyclobutyl}methanol
- Molecular Formula: C7H15NO
- Molecular Weight: 129.20
- InChI Key: PFLUXSYXRSXOFJ-UHFFFAOYSA-N
- InChI: InChI=1S/C7H15NO/c1-8-5-7(6-9)3-2-4-7/h8-9H,2-6H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 129.200 |
| Density: | 1.0±0.1 g/cm3 |
| CAS: | 180205-31-6 |
| Bolling_Point: | 192.0±13.0 °C at 760 mmHg |
| Product_Name: | {1-[(Methylamino)methyl]cyclobutyl}methanol |
| Melting_Point: | N/A |
| Flash_Point: | 68.6±10.5 °C |
| MF: | C7H15NO |
| Density: | 1.0±0.1 g/cm3 |
|---|---|
| LogP: | -0.14 |
| Flash_Point: | 68.6±10.5 °C |
| Refractive_Index: | 1.470 |
| FW: | 129.200 |
| PSA: | 32.26000 |
| MF: | C7H15NO |
| Bolling_Point: | 192.0±13.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.1±0.8 mmHg at 25°C |
| Exact_Mass: | 129.115356 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| RIDADR: | NONH for all modes of transport |
