2-(Ethylthio)propanoic acid
Catalog No: FT-0678998
CAS No: 20461-87-4
- Chemical Name: 2-(Ethylthio)propanoic acid
- Molecular Formula: C5H10O2S
- Molecular Weight: 134.20
- InChI Key: QSPCCDNHTPQDKL-UHFFFAOYSA-N
- InChI: InChI=1S/C5H10O2S/c1-3-8-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 134.19700 |
| Density: | 1.117g/cm3 |
| CAS: | 20461-87-4 |
| Bolling_Point: | 227.9ºC at 760 mmHg |
| Product_Name: | 2-ethylsulfanylpropanoic acid |
| Melting_Point: | N/A |
| Flash_Point: | 91.6ºC |
| MF: | C5H10O2S |
| Density: | 1.117g/cm3 |
|---|---|
| LogP: | 1.21260 |
| Flash_Point: | 91.6ºC |
| Refractive_Index: | 1.49 |
| FW: | 134.19700 |
| PSA: | 62.60000 |
| MF: | C5H10O2S |
| Bolling_Point: | 227.9ºC at 760 mmHg |
| Vapor_Pressure: | 0.0272mmHg at 25°C |
| Exact_Mass: | 134.04000 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2930909090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)