2-Chloro-N-methylisonicotinamide
Catalog No: FT-0678980
CAS No: 131418-11-6
- Chemical Name: 2-Chloro-N-methylisonicotinamide
- Molecular Formula: C7H7ClN2O
- Molecular Weight: 170.59
- InChI Key: HZCPKEZVYGEGEN-UHFFFAOYSA-N
- InChI: InChI=1S/C7H7ClN2O/c1-9-7(11)5-2-3-10-6(8)4-5/h2-4H,1H3,(H,9,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 170.59600 |
| Density: | 1.264g/cm3 |
| CAS: | 131418-11-6 |
| Bolling_Point: | 330.677ºC at 760 mmHg |
| Product_Name: | 2-Chloro-N-methylisonicotinamide |
| Melting_Point: | N/A |
| Flash_Point: | 153.789ºC |
| MF: | C7H7ClN2O |
| Density: | 1.264g/cm3 |
|---|---|
| LogP: | 1.48550 |
| Flash_Point: | 153.789ºC |
| Refractive_Index: | 1.548 |
| FW: | 170.59600 |
| PSA: | 41.99000 |
| MF: | C7H7ClN2O |
| Bolling_Point: | 330.677ºC at 760 mmHg |
| Vapor_Pressure: | 0mmHg at 25°C |
| Exact_Mass: | 170.02500 |
| Warning_Statement: | P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)