Azepan-1-yl-acetic acid
Catalog No: FT-0678702
CAS No: 52703-80-7
- Chemical Name: Azepan-1-yl-acetic acid
- Molecular Formula: C8H15NO2
- Molecular Weight: 157.21
- InChI Key: VVKHVWUCJZPGJH-UHFFFAOYSA-N
- InChI: InChI=1S/C8H15NO2/c10-8(11)7-9-5-3-1-2-4-6-9/h1-7H2,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-(azepan-1-yl)acetic acid |
|---|---|
| Flash_Point: | 117.4ºC |
| Melting_Point: | N/A |
| FW: | 157.21000 |
| Density: | 1.066g/cm3 |
| CAS: | 52703-80-7 |
| Bolling_Point: | 270.5ºC at 760 mmHg |
| MF: | C8H15NO2 |
| Density: | 1.066g/cm3 |
|---|---|
| LogP: | 0.88490 |
| Flash_Point: | 117.4ºC |
| Refractive_Index: | 1.483 |
| FW: | 157.21000 |
| PSA: | 40.54000 |
| MF: | C8H15NO2 |
| Bolling_Point: | 270.5ºC at 760 mmHg |
| Exact_Mass: | 157.11000 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Warning_Statement: | P273 |
| Safety_Statements: | H412 |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)