![5,7-Dimethyl[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxylic acid (CAS: 842972-32-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0678460.png "5,7-Dimethyl[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxylic acid chemical structure")
5,7-Dimethyl[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxylic acid
Catalog No: FT-0678460
CAS No: 842972-32-1
- Chemical Name: 5,7-Dimethyl[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxylic acid
- Molecular Formula: C8H8N4O2
- Molecular Weight: 192.17
- InChI Key: YFTGQBVYIOJXMV-UHFFFAOYSA-N
- InChI: InChI=1S/C8H8N4O2/c1-4-3-5(2)12-6(7(13)14)10-11-8(12)9-4/h3H,1-2H3,(H,13,14)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 192.17500 |
| Density: | 1.57g/cm3 |
| CAS: | 842972-32-1 |
| Bolling_Point: | N/A |
| Product_Name: | 5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxylic acid |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C8H8N4O2 |
| Density: | 1.57g/cm3 |
|---|---|
| LogP: | 0.43930 |
| Refractive_Index: | 1.73 |
| FW: | 192.17500 |
| PSA: | 80.38000 |
| MF: | C8H8N4O2 |
| Exact_Mass: | 192.06500 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | H302 |
| RIDADR: | NONH for all modes of transport |
![2-[4-[(dimethylamino)methyl]phenyl]acetic acid (CAS: 99985-52-1) - Related Chemical Product](/static/img/prod_pic/FT-0737063.png "2-[4-[(dimethylamino)methyl]phenyl]acetic acid chemical structure")
![2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol (CAS: 99982-60-2) - Related Chemical Product](/static/img/prod_pic/FT-0749988.png "2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol chemical structure")
