5-Bromo-2-chloronicotinaldehyde
Catalog No: FT-0678308
CAS No: 228251-24-9
- Chemical Name: 5-Bromo-2-chloronicotinaldehyde
- Molecular Formula: C6H3BrClNO
- Molecular Weight: 220.45
- InChI Key: YGPYNLZCNDPHTQ-UHFFFAOYSA-N
- InChI: InChI=1S/C6H3BrClNO/c7-5-1-4(3-10)6(8)9-2-5/h1-3H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 220.451 |
| Density: | 1.8±0.1 g/cm3 |
| CAS: | 228251-24-9 |
| Bolling_Point: | 278.0±35.0 °C at 760 mmHg |
| Product_Name: | 5-Bromo-2-chloronicotinaldehyde |
| Melting_Point: | N/A |
| Flash_Point: | 121.9±25.9 °C |
| MF: | C6H3BrClNO |
| Density: | 1.8±0.1 g/cm3 |
|---|---|
| LogP: | 2.40 |
| Flash_Point: | 121.9±25.9 °C |
| Refractive_Index: | 1.632 |
| FW: | 220.451 |
| PSA: | 29.96000 |
| MF: | C6H3BrClNO |
| Bolling_Point: | 278.0±35.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 218.908646 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P301 + P310 |
| Safety_Statements: | H301 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)