4-Bromothiophene-2-acetic acid
Catalog No: FT-0678223
CAS No: 161942-89-8
- Chemical Name: 4-Bromothiophene-2-acetic acid
- Molecular Formula: C6H5BrO2S
- Molecular Weight: 221.07
- InChI Key: RQLBAXZWESSFHI-UHFFFAOYSA-N
- InChI: InChI=1S/C6H5BrO2S/c7-4-1-5(10-3-4)2-6(8)9/h1,3H,2H2,(H,8,9)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 221.07200 |
| Density: | 1.804g/cm3 |
| CAS: | 161942-89-8 |
| Bolling_Point: | 331.2ºC at 760 mmHg |
| Product_Name: | 2-(4-bromothiophen-2-yl)acetic acid |
| Melting_Point: | N/A |
| Flash_Point: | 154.1ºC |
| MF: | C6H5BrO2S |
| Density: | 1.804g/cm3 |
|---|---|
| LogP: | 2.13770 |
| Flash_Point: | 154.1ºC |
| Refractive_Index: | 1.627 |
| FW: | 221.07200 |
| PSA: | 65.54000 |
| MF: | C6H5BrO2S |
| Bolling_Point: | 331.2ºC at 760 mmHg |
| Vapor_Pressure: | 6.33E-05mmHg at 25°C |
| Exact_Mass: | 219.91900 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)