![3-Iodo-5-methoxy-1H-pyrrolo[2,3-b]pyridine (CAS: 913983-33-2) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0678185.png "3-Iodo-5-methoxy-1H-pyrrolo[2,3-b]pyridine chemical structure")
3-Iodo-5-methoxy-1H-pyrrolo[2,3-b]pyridine
Catalog No: FT-0678185
CAS No: 913983-33-2
- Chemical Name: 3-Iodo-5-methoxy-1H-pyrrolo[2,3-b]pyridine
- Molecular Formula: C8H7IN2O
- Molecular Weight: 274.06
- InChI Key: FKIMIWSUCKEXLD-UHFFFAOYSA-N
- InChI: InChI=1S/C8H7IN2O/c1-12-5-2-6-7(9)4-11-8(6)10-3-5/h2-4H,1H3,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 274.058 |
| Density: | 1.9±0.1 g/cm3 |
| CAS: | 913983-33-2 |
| Bolling_Point: | N/A |
| Product_Name: | 3-Iodo-5-methoxy-1H-pyrrolo[2,3-b]pyridine |
| Melting_Point: | 172-173ºC |
| Flash_Point: | N/A |
| MF: | C8H7IN2O |
| Melting_Point: | 172-173ºC |
|---|---|
| Density: | 1.9±0.1 g/cm3 |
| LogP: | 3.17 |
| Refractive_Index: | 1.728 |
| FW: | 274.058 |
| PSA: | 37.91000 |
| MF: | C8H7IN2O |
| Exact_Mass: | 273.960297 |
| Hazard_Codes: | Xi |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
![1-[3-(DIMETHYLAMINO)PROPYL]PIPERAZINE (CAS: 877-96-3) - Related Chemical Product](/static/img/prod_pic/FT-0633063.png "1-[3-(DIMETHYLAMINO)PROPYL]PIPERAZINE chemical structure")
