![3-Iodo-1H-pyrrolo[2,3-b]pyridine-5-carbaldehyde (CAS: 900514-07-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0678182.png "3-Iodo-1H-pyrrolo[2,3-b]pyridine-5-carbaldehyde chemical structure")
3-Iodo-1H-pyrrolo[2,3-b]pyridine-5-carbaldehyde
Catalog No: FT-0678182
CAS No: 900514-07-0
- Chemical Name: 3-Iodo-1H-pyrrolo[2,3-b]pyridine-5-carbaldehyde
- Molecular Formula: C8H5IN2O
- Molecular Weight: 272.04
- InChI Key: DLDQOJMZUSYGSE-UHFFFAOYSA-N
- InChI: InChI=1S/C8H5IN2O/c9-7-3-11-8-6(7)1-5(4-12)2-10-8/h1-4H,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 272.043 |
| Density: | 2.1±0.1 g/cm3 |
| CAS: | 900514-07-0 |
| Bolling_Point: | N/A |
| Product_Name: | 3-Iodo-1H-pyrrolo[2,3-b]pyridine-5-carbaldehyde |
| Melting_Point: | 214-215ºC |
| Flash_Point: | N/A |
| MF: | C8H5IN2O |
| Melting_Point: | 214-215ºC |
|---|---|
| Density: | 2.1±0.1 g/cm3 |
| LogP: | 2.66 |
| Refractive_Index: | 1.824 |
| FW: | 272.043 |
| PSA: | 45.75000 |
| MF: | C8H5IN2O |
| Exact_Mass: | 271.944641 |
| Hazard_Codes: | Xi |
|---|---|
| Warning_Statement: | P280 |
| Safety_Statements: | H302-H317 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
