![5-Iodo-1H-pyrrolo[2,3-b]pyridine (CAS: 898746-50-4) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0678094.png "5-Iodo-1H-pyrrolo[2,3-b]pyridine chemical structure")
5-Iodo-1H-pyrrolo[2,3-b]pyridine
Catalog No: FT-0678094
CAS No: 898746-50-4
- Chemical Name: 5-Iodo-1H-pyrrolo[2,3-b]pyridine
- Molecular Formula: C7H5IN2
- Molecular Weight: 244.03
- InChI Key: CYMDPTJBUBTWEY-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5IN2/c8-6-3-5-1-2-9-7(5)10-4-6/h1-4H,(H,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 244.033 |
| Density: | 2.1±0.1 g/cm3 |
| CAS: | 898746-50-4 |
| Bolling_Point: | N/A |
| Product_Name: | 5-Iodo-1H-pyrrolo[2,3-b]pyridine |
| Melting_Point: | 196-197ºC |
| Flash_Point: | N/A |
| MF: | C7H5IN2 |
| Melting_Point: | 196-197ºC |
|---|---|
| Density: | 2.1±0.1 g/cm3 |
| LogP: | 3.19 |
| Refractive_Index: | 1.788 |
| FW: | 244.033 |
| PSA: | 28.68000 |
| MF: | C7H5IN2 |
| Exact_Mass: | 243.949738 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
(4S,6R)-6-Hydroxymethyl-2,2-dimethyl-1,3-dioxane-4-acetic Acid 1,1-Dimethylethyl Ester
