![1H-Pyrrolo[2,3-b]pyridine-5-carbonitrile (CAS: 517918-95-5) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0677980.png "1H-Pyrrolo[2,3-b]pyridine-5-carbonitrile chemical structure")
1H-Pyrrolo[2,3-b]pyridine-5-carbonitrile
Catalog No: FT-0677980
CAS No: 517918-95-5
- Chemical Name: 1H-Pyrrolo[2,3-b]pyridine-5-carbonitrile
- Molecular Formula: C8H5N3
- Molecular Weight: 143.15
- InChI Key: DRAQIXNADYAISI-UHFFFAOYSA-N
- InChI: InChI=1S/C8H5N3/c9-4-6-3-7-1-2-10-8(7)11-5-6/h1-3,5H,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 143.145 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 517918-95-5 |
| Bolling_Point: | 373.2±22.0 °C at 760 mmHg |
| Product_Name: | 5-Cyano-7-azaindole |
| Melting_Point: | 225.1-225.2ºC |
| Flash_Point: | 127.3±7.5 °C |
| MF: | C8H5N3 |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 2.09 |
| Flash_Point: | 127.3±7.5 °C |
| Melting_Point: | 225.1-225.2ºC |
| FW: | 143.145 |
| PSA: | 52.47000 |
| Exact_Mass: | 143.048340 |
| MF: | C8H5N3 |
| Bolling_Point: | 373.2±22.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Refractive_Index: | 1.685 |
| Hazard_Codes: | Xi |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)