2-Bromo-3-iodo-isonicotinic acid
Catalog No: FT-0677615
CAS No: 848243-29-8
- Chemical Name: 2-Bromo-3-iodo-isonicotinic acid
- Molecular Formula: C6H3BrINO2
- Molecular Weight: 327.90
- InChI Key: MCEFUWMDAAYELU-UHFFFAOYSA-N
- InChI: InChI=1S/C6H3BrINO2/c7-5-4(8)3(6(10)11)1-2-9-5/h1-2H,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-bromo-3-iodopyridine-4-carboxylic acid |
|---|---|
| Flash_Point: | 246.7ºC |
| Melting_Point: | 214-215ºC |
| FW: | 327.90200 |
| Density: | 2.457g/cm3 |
| CAS: | 848243-29-8 |
| Bolling_Point: | 484.3ºC at 760 mmHg |
| MF: | C6H3BrINO2 |
| Density: | 2.457g/cm3 |
|---|---|
| LogP: | 2.14690 |
| Flash_Point: | 246.7ºC |
| Melting_Point: | 214-215ºC |
| FW: | 327.90200 |
| PSA: | 50.19000 |
| Exact_Mass: | 326.83900 |
| MF: | C6H3BrINO2 |
| Bolling_Point: | 484.3ºC at 760 mmHg |
| Refractive_Index: | 1.705 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)