3-Methyl-1H-pyrazole-4-carboxylic acid
Catalog No: FT-0677171
CAS No: 40704-11-8
- Chemical Name: 3-Methyl-1H-pyrazole-4-carboxylic acid
- Molecular Formula: C5H6N2O2
- Molecular Weight: 126.11
- InChI Key: HLYYXPDTFLUERX-UHFFFAOYSA-N
- InChI: InChI=1S/C5H6N2O2/c1-3-4(5(8)9)2-6-7-3/h2H,1H3,(H,6,7)(H,8,9)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 3-Methyl-1H-pyrazole-4-carboxylic acid |
|---|---|
| Flash_Point: | 186.1ºC |
| Melting_Point: | 225-230ºC (dec.)(lit.) |
| FW: | 126.11300 |
| Density: | 1.404g/cm3 |
| CAS: | 40704-11-8 |
| Bolling_Point: | 384.2ºC at 760 mmHg |
| MF: | C5H6N2O2 |
| Density: | 1.404g/cm3 |
|---|---|
| LogP: | 0.41630 |
| Flash_Point: | 186.1ºC |
| Melting_Point: | 225-230ºC (dec.)(lit.) |
| FW: | 126.11300 |
| PSA: | 65.98000 |
| Exact_Mass: | 126.04300 |
| MF: | C5H6N2O2 |
| Bolling_Point: | 384.2ºC at 760 mmHg |
| Refractive_Index: | 1.595 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2933199090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)